C11H13N3OS — CID 5022451
prop-2-enyl N'-[(2-hydroxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 5022451) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is prop-2-enyl N'-[(2-hydroxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | prop-2-enyl N'-[(2-hydroxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 5022451 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | prop-2-enyl N'-[(2-hydroxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | C=CCSC(N)=NN=Cc1ccccc1O |
| InChI | InChI=1S/C11H13N3OS/c1-2-7-16-11(12)14-13-8-9-5-3-4-6-10(9)15/h2-6,8,15H,1,7H2,(H2,12,14) |
| InChIKey | FIUFPWSAHVJMGW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|