C24H23N5O2S — CID 168613221
benzyl N'-[[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]methylideneamino]carbamimidothioate (PubChem CID 168613221) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is benzyl N'-[[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613221 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | benzyl N'-[[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(N2CCc3ccccc3C2)c([N+](=O)[O-])c1)SCc1ccccc1 |
| InChI | InChI=1S/C24H23N5O2S/c25-24(32-17-18-6-2-1-3-7-18)27-26-15-19-10-11-22(23(14-19)29(30)31)28-13-12-20-8-4-5-9-21(20)16-28/h1-11,14-15H,12-13,16-17H2,(H2,25,27) |
| InChIKey | BXTCAVPTMHYHPT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|