C20H20N6O2S — CID 94849783
(Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3-nitro-4-pyrrolidin-1-ylphenyl)methanimine (PubChem CID 94849783) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3-nitro-4-pyrrolidin-1-ylphenyl)methanimine.
| Compound Name | (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3-nitro-4-pyrrolidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 94849783 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3-nitro-4-pyrrolidin-1-ylphenyl)methanimine |
| SMILES | O=[N+]([O-])c1cc(/C=N\n2cnnc2SCc2ccccc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C20H20N6O2S/c27-26(28)19-12-17(8-9-18(19)24-10-4-5-11-24)13-22-25-15-21-23-20(25)29-14-16-6-2-1-3-7-16/h1-3,6-9,12-13,15H,4-5,10-11,14H2/b22-13- |
| InChIKey | WVQVQDVMRQBJFB-XKZIYDEJSA-N |
| XLogP | 3.96 |
| TPSA | 89.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|