C27H27N7O2S — CID 23762502
1-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 23762502) has the molecular formula C27H27N7O2S and a molecular weight of 513.63 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 23762502 |
| Molecular Formula | C27H27N7O2S |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | O=[N+]([O-])c1cc(C=Nn2cnnc2SCc2ccccc2)ccc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H27N7O2S/c35-34(36)26-17-24(18-29-33-21-28-30-27(33)37-20-23-9-5-2-6-10-23)11-12-25(26)32-15-13-31(14-16-32)19-22-7-3-1-4-8-22/h1-12,17-18,21H,13-16,19-20H2 |
| InChIKey | AFZNGLCCMBDOLQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|