C17H14N4O2S — CID 71967020
2-[(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]benzoic acid (PubChem CID 71967020) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-[(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]benzoic acid.
| Compound Name | 2-[(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 71967020 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-[(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C=Nn1cnnc1SCc1ccccc1 |
| InChI | InChI=1S/C17H14N4O2S/c22-16(23)15-9-5-4-8-14(15)10-19-21-12-18-20-17(21)24-11-13-6-2-1-3-7-13/h1-10,12H,11H2,(H,22,23) |
| InChIKey | HAPLPGRRTZPILX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|