C16H11N5O4S-2 — CID 7710847
4-[(Z)-(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-6-nitrobenzene-1,3-diolate (PubChem CID 7710847) has the molecular formula C16H11N5O4S-2 and a molecular weight of 369.36 g/mol. Its IUPAC name is 4-[(Z)-(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-6-nitrobenzene-1,3-diolate.
| Compound Name | 4-[(Z)-(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-6-nitrobenzene-1,3-diolate |
|---|---|
| PubChem CID | 7710847 |
| Molecular Formula | C16H11N5O4S-2 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 4-[(Z)-(3-benzylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-6-nitrobenzene-1,3-diolate |
| SMILES | O=[N+]([O-])c1cc(/C=N\n2cnnc2SCc2ccccc2)c([O-])cc1[O-] |
| InChI | InChI=1S/C16H13N5O4S/c22-14-7-15(23)13(21(24)25)6-12(14)8-18-20-10-17-19-16(20)26-9-11-4-2-1-3-5-11/h1-8,10,22-23H,9H2/p-2/b18-8- |
| InChIKey | WYSLEKNCKXUVQR-LSCVHKIXSA-L |
| XLogP | 1.51 |
| TPSA | 132.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|