C23H26N6O2S — CID 94849777
(Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-[2-[(2S)-2-ethylpiperidin-1-yl]-5-nitrophenyl]methanimine (PubChem CID 94849777) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-[2-[(2S)-2-ethylpiperidin-1-yl]-5-nitrophenyl]methanimine.
| Compound Name | (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-[2-[(2S)-2-ethylpiperidin-1-yl]-5-nitrophenyl]methanimine |
|---|---|
| PubChem CID | 94849777 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-[2-[(2S)-2-ethylpiperidin-1-yl]-5-nitrophenyl]methanimine |
| SMILES | CC[C@H]1CCCCN1c1ccc([N+](=O)[O-])cc1/C=N\n1cnnc1SCc1ccccc1 |
| InChI | InChI=1S/C23H26N6O2S/c1-2-20-10-6-7-13-27(20)22-12-11-21(29(30)31)14-19(22)15-25-28-17-24-26-23(28)32-16-18-8-4-3-5-9-18/h3-5,8-9,11-12,14-15,17,20H,2,6-7,10,13,16H2,1H3/b25-15-/t20-/m0/s1 |
| InChIKey | FBQLZUXGQXEHCA-FXONECCMSA-N |
| XLogP | 5.13 |
| TPSA | 89.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|