C16H12ClN5O2S — CID 7574918
(Z)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(3-nitrophenyl)methanimine (PubChem CID 7574918) has the molecular formula C16H12ClN5O2S and a molecular weight of 373.83 g/mol. Its IUPAC name is (Z)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(3-nitrophenyl)methanimine.
| Compound Name | (Z)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 7574918 |
| Molecular Formula | C16H12ClN5O2S |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | (Z)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(3-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1cccc(/C=N\n2cnnc2SCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H12ClN5O2S/c17-15-7-2-1-5-13(15)10-25-16-20-18-11-21(16)19-9-12-4-3-6-14(8-12)22(23)24/h1-9,11H,10H2/b19-9- |
| InChIKey | JODVWBHCKUGJJT-OCKHKDLRSA-N |
| XLogP | 4.01 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|