C16H13ClN4O2S — CID 135552080
4-[(E)-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]benzene-1,3-diol (PubChem CID 135552080) has the molecular formula C16H13ClN4O2S and a molecular weight of 360.83 g/mol. Its IUPAC name is 4-[(E)-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135552080 |
| Molecular Formula | C16H13ClN4O2S |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 4-[(E)-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/n2cnnc2SCc2ccccc2Cl)c(O)c1 |
| InChI | InChI=1S/C16H13ClN4O2S/c17-14-4-2-1-3-12(14)9-24-16-20-18-10-21(16)19-8-11-5-6-13(22)7-15(11)23/h1-8,10,22-23H,9H2/b19-8+ |
| InChIKey | XKFBVTGLYDFMAZ-UFWORHAWSA-N |
| XLogP | 3.52 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|