C16H11Br2ClN4OS — CID 135667245
2,4-dibromo-6-[(E)-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]phenol (PubChem CID 135667245) has the molecular formula C16H11Br2ClN4OS and a molecular weight of 502.62 g/mol. Its IUPAC name is 2,4-dibromo-6-[(E)-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(E)-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135667245 |
| Molecular Formula | C16H11Br2ClN4OS |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 499.87 |
| IUPAC Name | 2,4-dibromo-6-[(E)-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/n1cnnc1SCc1ccccc1Cl |
| InChI | InChI=1S/C16H11Br2ClN4OS/c17-12-5-11(15(24)13(18)6-12)7-21-23-9-20-22-16(23)25-8-10-3-1-2-4-14(10)19/h1-7,9,24H,8H2/b21-7+ |
| InChIKey | YPLZBXMEXNMNRH-QPSGOUHRSA-N |
| XLogP | 5.34 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|