C17H15BrN4OS — CID 1181357
4-bromo-2-[[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]phenol (PubChem CID 1181357) has the molecular formula C17H15BrN4OS and a molecular weight of 403.31 g/mol. Its IUPAC name is 4-bromo-2-[[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]phenol.
| Compound Name | 4-bromo-2-[[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 1181357 |
| Molecular Formula | C17H15BrN4OS |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 4-bromo-2-[[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]iminomethyl]phenol |
| SMILES | Cc1ccc(CSc2nncn2N=Cc2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C17H15BrN4OS/c1-12-2-4-13(5-3-12)10-24-17-21-19-11-22(17)20-9-14-8-15(18)6-7-16(14)23/h2-9,11,23H,10H2,1H3 |
| InChIKey | HTXLYGZMCBETKT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|