C16H15N5S — CID 6870154
(E)-N-[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-pyridin-4-ylmethanimine (PubChem CID 6870154) has the molecular formula C16H15N5S and a molecular weight of 309.40 g/mol. Its IUPAC name is (E)-N-[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-pyridin-4-ylmethanimine.
| Compound Name | (E)-N-[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-pyridin-4-ylmethanimine |
|---|---|
| PubChem CID | 6870154 |
| Molecular Formula | C16H15N5S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (E)-N-[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-pyridin-4-ylmethanimine |
| SMILES | Cc1ccc(CSc2nncn2/N=C/c2ccncc2)cc1 |
| InChI | InChI=1S/C16H15N5S/c1-13-2-4-15(5-3-13)11-22-16-20-18-12-21(16)19-10-14-6-8-17-9-7-14/h2-10,12H,11H2,1H3/b19-10+ |
| InChIKey | DGLFGAVTDQQBSL-VXLYETTFSA-N |
| XLogP | 3.16 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|