C17H15ClN4S — CID 5398702
(Z)-1-(3-chlorophenyl)-N-[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine (PubChem CID 5398702) has the molecular formula C17H15ClN4S and a molecular weight of 342.86 g/mol. Its IUPAC name is (Z)-1-(3-chlorophenyl)-N-[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine.
| Compound Name | (Z)-1-(3-chlorophenyl)-N-[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 5398702 |
| Molecular Formula | C17H15ClN4S |
| Molecular Weight | 342.86 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (Z)-1-(3-chlorophenyl)-N-[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine |
| SMILES | Cc1ccc(CSc2nncn2/N=C\c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H15ClN4S/c1-13-5-7-14(8-6-13)11-23-17-21-19-12-22(17)20-10-15-3-2-4-16(18)9-15/h2-10,12H,11H2,1H3/b20-10- |
| InChIKey | YKMGGOUMRXPHPD-JMIUGGIZSA-N |
| XLogP | 4.41 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.86 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|