C26H28N4O4 — CID 4054279
N-[[2-(2-ethylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-2-naphthalen-1-yloxyacetamide (PubChem CID 4054279) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is N-[[2-(2-ethylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-2-naphthalen-1-yloxyacetamide.
| Compound Name | N-[[2-(2-ethylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-2-naphthalen-1-yloxyacetamide |
|---|---|
| PubChem CID | 4054279 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N-[[2-(2-ethylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-2-naphthalen-1-yloxyacetamide |
| SMILES | CCC1CCCCN1c1ccc([N+](=O)[O-])cc1C=NNC(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C26H28N4O4/c1-2-21-10-5-6-15-29(21)24-14-13-22(30(32)33)16-20(24)17-27-28-26(31)18-34-25-12-7-9-19-8-3-4-11-23(19)25/h3-4,7-9,11-14,16-17,21H,2,5-6,10,15,18H2,1H3,(H,28,31) |
| InChIKey | LPZBLWSVDNXZLF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|