C20H20Cl2N4O4 — CID 56694365
2-(2,4-dichlorophenoxy)-N-[(E)-(5-nitro-2-piperidin-1-ylphenyl)methylideneamino]acetamide (PubChem CID 56694365) has the molecular formula C20H20Cl2N4O4 and a molecular weight of 451.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(E)-(5-nitro-2-piperidin-1-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(E)-(5-nitro-2-piperidin-1-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 56694365 |
| Molecular Formula | C20H20Cl2N4O4 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(E)-(5-nitro-2-piperidin-1-ylphenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C/c1cc([N+](=O)[O-])ccc1N1CCCCC1 |
| InChI | InChI=1S/C20H20Cl2N4O4/c21-15-4-7-19(17(22)11-15)30-13-20(27)24-23-12-14-10-16(26(28)29)5-6-18(14)25-8-2-1-3-9-25/h4-7,10-12H,1-3,8-9,13H2,(H,24,27)/b23-12+ |
| InChIKey | CCECNWGYHKIGFV-FSJBWODESA-N |
| XLogP | 4.42 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|