C21H22Cl2N4O4 — CID 92652307
N-[(Z)-[2-(azepan-1-yl)-5-nitrophenyl]methylideneamino]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 92652307) has the molecular formula C21H22Cl2N4O4 and a molecular weight of 465.34 g/mol. Its IUPAC name is N-[(Z)-[2-(azepan-1-yl)-5-nitrophenyl]methylideneamino]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-[2-(azepan-1-yl)-5-nitrophenyl]methylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 92652307 |
| Molecular Formula | C21H22Cl2N4O4 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-[(Z)-[2-(azepan-1-yl)-5-nitrophenyl]methylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C\c1cc([N+](=O)[O-])ccc1N1CCCCCC1 |
| InChI | InChI=1S/C21H22Cl2N4O4/c22-16-5-8-20(18(23)12-16)31-14-21(28)25-24-13-15-11-17(27(29)30)6-7-19(15)26-9-3-1-2-4-10-26/h5-8,11-13H,1-4,9-10,14H2,(H,25,28)/b24-13- |
| InChIKey | ZWKSWGLKTFVQGY-CFRMEGHHSA-N |
| XLogP | 4.81 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|