C31H38N6O4S — CID 124530191
5-[[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]methylideneamino]-N,N-dimethyl-2-piperidin-1-ylbenzenesulfonamide (PubChem CID 124530191) has the molecular formula C31H38N6O4S and a molecular weight of 590.75 g/mol. Its IUPAC name is 5-[[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]methylideneamino]-N,N-dimethyl-2-piperidin-1-ylbenzenesulfonamide.
| Compound Name | 5-[[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]methylideneamino]-N,N-dimethyl-2-piperidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 124530191 |
| Molecular Formula | C31H38N6O4S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 5-[[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]methylideneamino]-N,N-dimethyl-2-piperidin-1-ylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(/N=C/c2ccc(N3CCN(Cc4ccccc4)CC3)c([N+](=O)[O-])c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C31H38N6O4S/c1-33(2)42(40,41)31-22-27(12-14-29(31)35-15-7-4-8-16-35)32-23-26-11-13-28(30(21-26)37(38)39)36-19-17-34(18-20-36)24-25-9-5-3-6-10-25/h3,5-6,9-14,21-23H,4,7-8,15-20,24H2,1-2H3/b32-23+ |
| InChIKey | RZHFQCMIXJFCET-AWSUPERCSA-N |
| XLogP | 4.91 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|