C28H41N5O4S — CID 124530190
5-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylideneamino]-N,N-dimethyl-2-piperidin-1-ylbenzenesulfonamide (PubChem CID 124530190) has the molecular formula C28H41N5O4S and a molecular weight of 543.73 g/mol. Its IUPAC name is 5-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylideneamino]-N,N-dimethyl-2-piperidin-1-ylbenzenesulfonamide.
| Compound Name | 5-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylideneamino]-N,N-dimethyl-2-piperidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 124530190 |
| Molecular Formula | C28H41N5O4S |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 5-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylideneamino]-N,N-dimethyl-2-piperidin-1-ylbenzenesulfonamide |
| SMILES | CC(C)CN(CC(C)C)c1ccc(/C=N/c2ccc(N3CCCCC3)c(S(=O)(=O)N(C)C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H41N5O4S/c1-21(2)19-32(20-22(3)4)25-12-10-23(16-27(25)33(34)35)18-29-24-11-13-26(31-14-8-7-9-15-31)28(17-24)38(36,37)30(5)6/h10-13,16-18,21-22H,7-9,14-15,19-20H2,1-6H3/b29-18+ |
| InChIKey | IIXJIGKBKMJYEB-RDRPBHBLSA-N |
| XLogP | 5.70 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|