C25H33N5O4S — CID 94849818
N,N-dimethyl-5-[(5-nitro-2-piperidin-1-ylphenyl)methylideneamino]-2-piperidin-1-ylbenzenesulfonamide (PubChem CID 94849818) has the molecular formula C25H33N5O4S and a molecular weight of 499.64 g/mol. Its IUPAC name is N,N-dimethyl-5-[(5-nitro-2-piperidin-1-ylphenyl)methylideneamino]-2-piperidin-1-ylbenzenesulfonamide.
| Compound Name | N,N-dimethyl-5-[(5-nitro-2-piperidin-1-ylphenyl)methylideneamino]-2-piperidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 94849818 |
| Molecular Formula | C25H33N5O4S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | N,N-dimethyl-5-[(5-nitro-2-piperidin-1-ylphenyl)methylideneamino]-2-piperidin-1-ylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(/N=C/c2cc([N+](=O)[O-])ccc2N2CCCCC2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C25H33N5O4S/c1-27(2)35(33,34)25-18-21(9-11-24(25)29-15-7-4-8-16-29)26-19-20-17-22(30(31)32)10-12-23(20)28-13-5-3-6-14-28/h9-12,17-19H,3-8,13-16H2,1-2H3/b26-19+ |
| InChIKey | ZADPVACRBAFASC-LGUFXXKBSA-N |
| XLogP | 4.58 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|