C19H18N6O3S — CID 168613029
benzyl N'-[[4-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613029) has the molecular formula C19H18N6O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is benzyl N'-[[4-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613029 |
| Molecular Formula | C19H18N6O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | benzyl N'-[[4-[(3-nitropyrazol-1-yl)methoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(OCn2ccc([N+](=O)[O-])n2)cc1)SCc1ccccc1 |
| InChI | InChI=1S/C19H18N6O3S/c20-19(29-13-16-4-2-1-3-5-16)22-21-12-15-6-8-17(9-7-15)28-14-24-11-10-18(23-24)25(26)27/h1-12H,13-14H2,(H2,20,22) |
| InChIKey | HCEJPUPFULGVLU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|