C27H30N4O11S — CID 22864772
(4-nitrophenyl)methyl (2R,4S)-2-[2-acetyloxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]-4-acetylsulfanylpyrrolidine-1-carboxylate (PubChem CID 22864772) has the molecular formula C27H30N4O11S and a molecular weight of 618.62 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4S)-2-[2-acetyloxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]-4-acetylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4S)-2-[2-acetyloxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]-4-acetylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22864772 |
| Molecular Formula | C27H30N4O11S |
| Molecular Weight | 618.62 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4S)-2-[2-acetyloxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]-4-acetylsulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(=O)OC(CNC(=O)OCc1ccc([N+](=O)[O-])cc1)C[C@@H]1C[C@H](SC(C)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H30N4O11S/c1-17(32)42-24(13-28-26(34)40-15-19-3-7-21(8-4-19)30(36)37)11-23-12-25(43-18(2)33)14-29(23)27(35)41-16-20-5-9-22(10-6-20)31(38)39/h3-10,23-25H,11-16H2,1-2H3,(H,28,34)/t23-,24?,25+/m1/s1 |
| InChIKey | HAFKNJSWBLXQFU-PPCJQXESSA-N |
| XLogP | 4.11 |
| TPSA | 197.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|