C27H32N4O9S — CID 22864776
(4-nitrophenyl)methyl (2R,4S)-4-acetylsulfanyl-2-[2-methyl-2-[methyl-[(4-nitrophenyl)methoxycarbonyl]amino]propyl]pyrrolidine-1-carboxylate (PubChem CID 22864776) has the molecular formula C27H32N4O9S and a molecular weight of 588.64 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4S)-4-acetylsulfanyl-2-[2-methyl-2-[methyl-[(4-nitrophenyl)methoxycarbonyl]amino]propyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4S)-4-acetylsulfanyl-2-[2-methyl-2-[methyl-[(4-nitrophenyl)methoxycarbonyl]amino]propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22864776 |
| Molecular Formula | C27H32N4O9S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4S)-4-acetylsulfanyl-2-[2-methyl-2-[methyl-[(4-nitrophenyl)methoxycarbonyl]amino]propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@@H](CC(C)(C)N(C)C(=O)OCc2ccc([N+](=O)[O-])cc2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C27H32N4O9S/c1-18(32)41-24-13-23(29(15-24)26(34)40-17-20-7-11-22(12-8-20)31(37)38)14-27(2,3)28(4)25(33)39-16-19-5-9-21(10-6-19)30(35)36/h5-12,23-24H,13-17H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | ZIYHIHYNGZESPT-ZEQRLZLVSA-N |
| XLogP | 5.30 |
| TPSA | 162.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|