C18H20N4O7S — CID 57211123
(4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(5-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 57211123) has the molecular formula C18H20N4O7S and a molecular weight of 436.45 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(5-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(5-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57211123 |
| Molecular Formula | C18H20N4O7S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[(5-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@@H](Cn2cc(O)[nH]c2=O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H20N4O7S/c1-11(23)30-15-6-14(7-20-9-16(24)19-17(20)25)21(8-15)18(26)29-10-12-2-4-13(5-3-12)22(27)28/h2-5,9,14-15,24H,6-8,10H2,1H3,(H,19,25)/t14-,15-/m0/s1 |
| InChIKey | XYFBQXTYWOGAME-GJZGRUSLSA-N |
| XLogP | 1.85 |
| TPSA | 147.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|