C35H39N5O6SSi — CID 151683533
(4-nitrophenyl)methyl (3R)-3-[[2-(2-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate (PubChem CID 151683533) has the molecular formula C35H39N5O6SSi and a molecular weight of 685.88 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3R)-3-[[2-(2-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3R)-3-[[2-(2-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151683533 |
| Molecular Formula | C35H39N5O6SSi |
| Molecular Weight | 685.88 g/mol |
| Exact Mass | 685.24 |
| IUPAC Name | (4-nitrophenyl)methyl (3R)-3-[[2-(2-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CCCCC1(O[SiH](c2ccccc2)c2ccccc2)CCN1c1nc(C(=O)N[C@@H]2CCN(C(=O)OCc3ccc([N+](=O)[O-])cc3)C2)cs1 |
| InChI | InChI=1S/C35H39N5O6SSi/c1-2-3-19-35(46-48(29-10-6-4-7-11-29)30-12-8-5-9-13-30)20-22-39(35)33-37-31(25-47-33)32(41)36-27-18-21-38(23-27)34(42)45-24-26-14-16-28(17-15-26)40(43)44/h4-17,25,27,48H,2-3,18-24H2,1H3,(H,36,41)/t27-,35?/m1/s1 |
| InChIKey | RBAVTUGTNNISSZ-SDTLAYBJSA-N |
| XLogP | 4.84 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|