C18H24N4O6S2 — CID 139980898
2-acetyloxyethyl (3S)-3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate (PubChem CID 139980898) has the molecular formula C18H24N4O6S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-acetyloxyethyl (3S)-3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | 2-acetyloxyethyl (3S)-3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139980898 |
| Molecular Formula | C18H24N4O6S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2-acetyloxyethyl (3S)-3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)OCCOC(=O)N1CC[C@H](NC(=O)c2csc(N3CC(SC(C)=O)C3)n2)C1 |
| InChI | InChI=1S/C18H24N4O6S2/c1-11(23)27-5-6-28-18(26)21-4-3-13(7-21)19-16(25)15-10-29-17(20-15)22-8-14(9-22)30-12(2)24/h10,13-14H,3-9H2,1-2H3,(H,19,25)/t13-/m0/s1 |
| InChIKey | QMXRCUGUGODBKL-ZDUSSCGKSA-N |
| XLogP | 1.12 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|