C18H24N4O6S2 — CID 139980927
[(1R)-1-acetyloxyethyl] (3R)-3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate (PubChem CID 139980927) has the molecular formula C18H24N4O6S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is [(1R)-1-acetyloxyethyl] (3R)-3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | [(1R)-1-acetyloxyethyl] (3R)-3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139980927 |
| Molecular Formula | C18H24N4O6S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | [(1R)-1-acetyloxyethyl] (3R)-3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)O[C@@H](C)OC(=O)N1CC[C@@H](NC(=O)c2csc(N3CC(SC(C)=O)C3)n2)C1 |
| InChI | InChI=1S/C18H24N4O6S2/c1-10(23)27-12(3)28-18(26)21-5-4-13(6-21)19-16(25)15-9-29-17(20-15)22-7-14(8-22)30-11(2)24/h9,12-14H,4-8H2,1-3H3,(H,19,25)/t12-,13-/m1/s1 |
| InChIKey | LZZZOBIOWMXFMD-CHWSQXEVSA-N |
| XLogP | 1.46 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|