C16H22N4O6S — CID 139980911
1-acetyloxyethyl (3S)-3-[[2-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate (PubChem CID 139980911) has the molecular formula C16H22N4O6S and a molecular weight of 398.44 g/mol. Its IUPAC name is 1-acetyloxyethyl (3S)-3-[[2-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | 1-acetyloxyethyl (3S)-3-[[2-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139980911 |
| Molecular Formula | C16H22N4O6S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-acetyloxyethyl (3S)-3-[[2-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)OC(C)OC(=O)N1CC[C@H](NC(=O)c2csc(N3CC(O)C3)n2)C1 |
| InChI | InChI=1S/C16H22N4O6S/c1-9(21)25-10(2)26-16(24)19-4-3-11(5-19)17-14(23)13-8-27-15(18-13)20-6-12(22)7-20/h8,10-12,22H,3-7H2,1-2H3,(H,17,23)/t10?,11-/m0/s1 |
| InChIKey | SZZOYDKVKCYUKN-DTIOYNMSSA-N |
| XLogP | 0.17 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|