C14H22N4O2S2 — CID 139980939
S-[1-[4-[[(2S)-1-amino-3-methylbutan-2-yl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate (PubChem CID 139980939) has the molecular formula C14H22N4O2S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is S-[1-[4-[[(2S)-1-amino-3-methylbutan-2-yl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate.
| Compound Name | S-[1-[4-[[(2S)-1-amino-3-methylbutan-2-yl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 139980939 |
| Molecular Formula | C14H22N4O2S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | S-[1-[4-[[(2S)-1-amino-3-methylbutan-2-yl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CN(c2nc(C(=O)N[C@H](CN)C(C)C)cs2)C1 |
| InChI | InChI=1S/C14H22N4O2S2/c1-8(2)11(4-15)16-13(20)12-7-21-14(17-12)18-5-10(6-18)22-9(3)19/h7-8,10-11H,4-6,15H2,1-3H3,(H,16,20)/t11-/m1/s1 |
| InChIKey | MJDRCIOMQGAZLA-LLVKDONJSA-N |
| XLogP | 1.32 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|