C14H15N3O2S3 — CID 22242959
S-[1-[4-[(thiophene-2-carbonylamino)methyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate (PubChem CID 22242959) has the molecular formula C14H15N3O2S3 and a molecular weight of 353.49 g/mol. Its IUPAC name is S-[1-[4-[(thiophene-2-carbonylamino)methyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate.
| Compound Name | S-[1-[4-[(thiophene-2-carbonylamino)methyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 22242959 |
| Molecular Formula | C14H15N3O2S3 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | S-[1-[4-[(thiophene-2-carbonylamino)methyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CN(c2nc(CNC(=O)c3cccs3)cs2)C1 |
| InChI | InChI=1S/C14H15N3O2S3/c1-9(18)22-11-6-17(7-11)14-16-10(8-21-14)5-15-13(19)12-3-2-4-20-12/h2-4,8,11H,5-7H2,1H3,(H,15,19) |
| InChIKey | FPVZHLIVBBLGDQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|