C8H8N4OS — CID 60982202
N-(1H-1,2,4-triazol-5-ylmethyl)thiophene-2-carboxamide (PubChem CID 60982202) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)thiophene-2-carboxamide.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 60982202 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1ncn[nH]1)c1cccs1 |
| InChI | InChI=1S/C8H8N4OS/c13-8(6-2-1-3-14-6)9-4-7-10-5-11-12-7/h1-3,5H,4H2,(H,9,13)(H,10,11,12) |
| InChIKey | HWIIXXKZDFZGIR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |