C13H17N5O2S — CID 64517630
N-[1-oxo-1-[3-(1H-1,2,4-triazol-5-yl)propylamino]propan-2-yl]thiophene-2-carboxamide (PubChem CID 64517630) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[1-oxo-1-[3-(1H-1,2,4-triazol-5-yl)propylamino]propan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-oxo-1-[3-(1H-1,2,4-triazol-5-yl)propylamino]propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 64517630 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[1-oxo-1-[3-(1H-1,2,4-triazol-5-yl)propylamino]propan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cccs1)C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H17N5O2S/c1-9(17-13(20)10-4-3-7-21-10)12(19)14-6-2-5-11-15-8-16-18-11/h3-4,7-9H,2,5-6H2,1H3,(H,14,19)(H,17,20)(H,15,16,18) |
| InChIKey | ULYFIWCVFRDVIV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|