C12H16N4OS2 — CID 64519144
2-(thiophen-2-ylmethylsulfanyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide (PubChem CID 64519144) has the molecular formula C12H16N4OS2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-(thiophen-2-ylmethylsulfanyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide.
| Compound Name | 2-(thiophen-2-ylmethylsulfanyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 64519144 |
| Molecular Formula | C12H16N4OS2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(thiophen-2-ylmethylsulfanyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
| SMILES | O=C(CSCc1cccs1)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H16N4OS2/c17-12(8-18-7-10-3-2-6-19-10)13-5-1-4-11-14-9-15-16-11/h2-3,6,9H,1,4-5,7-8H2,(H,13,17)(H,14,15,16) |
| InChIKey | GYOPJZHUCKQUFG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|