C13H15BrN4OS — CID 64546662
2-(4-bromophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide (PubChem CID 64546662) has the molecular formula C13H15BrN4OS and a molecular weight of 355.26 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 64546662 |
| Molecular Formula | C13H15BrN4OS |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
| SMILES | O=C(CSc1ccc(Br)cc1)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H15BrN4OS/c14-10-3-5-11(6-4-10)20-8-13(19)15-7-1-2-12-16-9-17-18-12/h3-6,9H,1-2,7-8H2,(H,15,19)(H,16,17,18) |
| InChIKey | QZMUWZFLFFXQNH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|