C11H15N2O3S- — CID 23047137
N-[1-oxo-1-(3-thiophen-2-ylpropylamino)propan-2-yl]carbamate (PubChem CID 23047137) has the molecular formula C11H15N2O3S- and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[1-oxo-1-(3-thiophen-2-ylpropylamino)propan-2-yl]carbamate.
| Compound Name | N-[1-oxo-1-(3-thiophen-2-ylpropylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 23047137 |
| Molecular Formula | C11H15N2O3S- |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[1-oxo-1-(3-thiophen-2-ylpropylamino)propan-2-yl]carbamate |
| SMILES | CC(NC(=O)[O-])C(=O)NCCCc1cccs1 |
| InChI | InChI=1S/C11H16N2O3S/c1-8(13-11(15)16)10(14)12-6-2-4-9-5-3-7-17-9/h3,5,7-8,13H,2,4,6H2,1H3,(H,12,14)(H,15,16)/p-1 |
| InChIKey | ZTDGRTFWWPJDKO-UHFFFAOYSA-M |
| XLogP | 0.12 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|