C17H20N2O3S — CID 18111263
benzyl N-[(2S)-1-oxo-1-(2-thiophen-2-ylethylamino)propan-2-yl]carbamate (PubChem CID 18111263) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-(2-thiophen-2-ylethylamino)propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-(2-thiophen-2-ylethylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 18111263 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-(2-thiophen-2-ylethylamino)propan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C17H20N2O3S/c1-13(16(20)18-10-9-15-8-5-11-23-15)19-17(21)22-12-14-6-3-2-4-7-14/h2-8,11,13H,9-10,12H2,1H3,(H,18,20)(H,19,21)/t13-/m0/s1 |
| InChIKey | BIIXFFARHTWIAO-ZDUSSCGKSA-N |
| XLogP | 2.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |