C21H27N5O6S — CID 139665082
(4-nitrophenyl)methyl 2-[(3R)-1-[(2S,4S)-4-acetylsulfanyl-1-methylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]imino-2-aminoacetate (PubChem CID 139665082) has the molecular formula C21H27N5O6S and a molecular weight of 477.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(3R)-1-[(2S,4S)-4-acetylsulfanyl-1-methylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]imino-2-aminoacetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(3R)-1-[(2S,4S)-4-acetylsulfanyl-1-methylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]imino-2-aminoacetate |
|---|---|
| PubChem CID | 139665082 |
| Molecular Formula | C21H27N5O6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(3R)-1-[(2S,4S)-4-acetylsulfanyl-1-methylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]imino-2-aminoacetate |
| SMILES | CC(=O)S[C@H]1C[C@@H](C(=O)N2CC[C@@H](/N=C(\N)C(=O)OCc3ccc([N+](=O)[O-])cc3)C2)N(C)C1 |
| InChI | InChI=1S/C21H27N5O6S/c1-13(27)33-17-9-18(24(2)11-17)20(28)25-8-7-15(10-25)23-19(22)21(29)32-12-14-3-5-16(6-4-14)26(30)31/h3-6,15,17-18H,7-12H2,1-2H3,(H2,22,23)/t15-,17+,18+/m1/s1 |
| InChIKey | NJJKWDVXIIOTMC-NJAFHUGGSA-N |
| XLogP | 0.95 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|