C26H32N4O7S — CID 57158023
(4-nitrophenyl)methyl (2S,4S)-2-[3-(hydroxymethyl)piperazine-1-carbonyl]-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate (PubChem CID 57158023) has the molecular formula C26H32N4O7S and a molecular weight of 544.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[3-(hydroxymethyl)piperazine-1-carbonyl]-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[3-(hydroxymethyl)piperazine-1-carbonyl]-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57158023 |
| Molecular Formula | C26H32N4O7S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[3-(hydroxymethyl)piperazine-1-carbonyl]-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(CS[C@H]2C[C@@H](C(=O)N3CCNC(CO)C3)N(C(=O)OCc3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C26H32N4O7S/c1-36-22-8-4-19(5-9-22)17-38-23-12-24(25(32)28-11-10-27-20(13-28)15-31)29(14-23)26(33)37-16-18-2-6-21(7-3-18)30(34)35/h2-9,20,23-24,27,31H,10-17H2,1H3/t20?,23-,24-/m0/s1 |
| InChIKey | IZIVUUNPMANSBA-BMTNDILFSA-N |
| XLogP | 2.41 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|