C28H35N5O8S — CID 67585301
(4-nitrophenyl)methyl (2S,4S)-4-(2-carbamoyloxyethyl)-4-[(4-methoxyphenyl)methylsulfanyl]-2-(piperazine-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 67585301) has the molecular formula C28H35N5O8S and a molecular weight of 601.68 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-(2-carbamoyloxyethyl)-4-[(4-methoxyphenyl)methylsulfanyl]-2-(piperazine-1-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-(2-carbamoyloxyethyl)-4-[(4-methoxyphenyl)methylsulfanyl]-2-(piperazine-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67585301 |
| Molecular Formula | C28H35N5O8S |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-(2-carbamoyloxyethyl)-4-[(4-methoxyphenyl)methylsulfanyl]-2-(piperazine-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(CS[C@]2(CCOC(N)=O)C[C@@H](C(=O)N3CCNCC3)N(C(=O)OCc3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C28H35N5O8S/c1-39-23-8-4-21(5-9-23)18-42-28(10-15-40-26(29)35)16-24(25(34)31-13-11-30-12-14-31)32(19-28)27(36)41-17-20-2-6-22(7-3-20)33(37)38/h2-9,24,30H,10-19H2,1H3,(H2,29,35)/t24-,28+/m0/s1 |
| InChIKey | WJWXTOKACZAEID-RBJSKKJNSA-N |
| XLogP | 2.90 |
| TPSA | 166.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|