C28H39N3O8Si — CID 70357509
(4-methoxyphenyl)methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[[(4-nitrophenyl)methoxycarbonylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 70357509) has the molecular formula C28H39N3O8Si and a molecular weight of 573.72 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[[(4-nitrophenyl)methoxycarbonylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[[(4-nitrophenyl)methoxycarbonylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70357509 |
| Molecular Formula | C28H39N3O8Si |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | (4-methoxyphenyl)methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[[(4-nitrophenyl)methoxycarbonylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2CC[C@](CNC(=O)OCc3ccc([N+](=O)[O-])cc3)(O[Si](C)(C)C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C28H39N3O8Si/c1-27(2,3)40(5,6)39-28(19-29-25(32)37-17-21-7-11-23(12-8-21)31(34)35)15-16-30(20-28)26(33)38-18-22-9-13-24(36-4)14-10-22/h7-14H,15-20H2,1-6H3,(H,29,32)/t28-/m1/s1 |
| InChIKey | CMTFKIWXWAPGTN-MUUNZHRXSA-N |
| XLogP | 5.63 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|