C20H30N2O7Si — CID 152761810
2-O-methyl 1-O-[(4-nitrophenyl)methyl] (2S,4R)-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 152761810) has the molecular formula C20H30N2O7Si and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-O-methyl 1-O-[(4-nitrophenyl)methyl] (2S,4R)-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-methyl 1-O-[(4-nitrophenyl)methyl] (2S,4R)-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 152761810 |
| Molecular Formula | C20H30N2O7Si |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-O-methyl 1-O-[(4-nitrophenyl)methyl] (2S,4R)-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@]1(O[SiH](C)C)C[C@H](C(C)(C)C)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H30N2O7Si/c1-19(2,3)15-11-20(17(23)27-4,29-30(5)6)21(12-15)18(24)28-13-14-7-9-16(10-8-14)22(25)26/h7-10,15,30H,11-13H2,1-6H3/t15-,20-/m0/s1 |
| InChIKey | ZLLFVXMQWPDUFV-YWZLYKJASA-N |
| XLogP | 3.47 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|