C30H42N4O10SSi — CID 173404083
(4-nitrophenyl)methyl (2R,4R)-4-tert-butyl-2-[[2-hydroxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]sulfanylmethyl]-3,3-dimethyl-2-silyloxypyrrolidine-1-carboxylate (PubChem CID 173404083) has the molecular formula C30H42N4O10SSi and a molecular weight of 678.84 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4R)-4-tert-butyl-2-[[2-hydroxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]sulfanylmethyl]-3,3-dimethyl-2-silyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4R)-4-tert-butyl-2-[[2-hydroxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]sulfanylmethyl]-3,3-dimethyl-2-silyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173404083 |
| Molecular Formula | C30H42N4O10SSi |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4R)-4-tert-butyl-2-[[2-hydroxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]sulfanylmethyl]-3,3-dimethyl-2-silyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[C@H]1CN(C(=O)OCc2ccc([N+](=O)[O-])cc2)[C@@](CSCC(O)CNC(=O)OCc2ccc([N+](=O)[O-])cc2)(O[SiH3])C1(C)C |
| InChI | InChI=1S/C30H42N4O10SSi/c1-28(2,3)25-15-32(27(37)43-17-21-8-12-23(13-9-21)34(40)41)30(44-46,29(25,4)5)19-45-18-24(35)14-31-26(36)42-16-20-6-10-22(11-7-20)33(38)39/h6-13,24-25,35H,14-19H2,1-5,46H3,(H,31,36)/t24?,25-,30+/m1/s1 |
| InChIKey | ZLEHCZXBYWPXBE-RJMZRKIXSA-N |
| XLogP | 4.16 |
| TPSA | 183.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|