C23H33N3O7Si — CID 173335567
(4-nitrophenyl)methyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrrolidine-1-carboxylate (PubChem CID 173335567) has the molecular formula C23H33N3O7Si and a molecular weight of 491.62 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173335567 |
| Molecular Formula | C23H33N3O7Si |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrrolidine-1-carboxylate |
| SMILES | CN1C(=O)CC([C@@]2(O[SiH](C)C)C[C@H](C(C)(C)C)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C23H33N3O7Si/c1-22(2,3)16-12-23(33-34(5)6,18-11-19(27)24(4)20(18)28)25(13-16)21(29)32-14-15-7-9-17(10-8-15)26(30)31/h7-10,16,18,34H,11-14H2,1-6H3/t16-,18?,23-/m0/s1 |
| InChIKey | QTPYVKRPGQUAHL-RAEDPMGTSA-N |
| XLogP | 3.30 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|