C17H21N3O6S — CID 175213833
(4-nitrophenyl)methyl (2R,4S)-4-acetyl-2-(dimethylcarbamoyl)-2-sulfanylpyrrolidine-1-carboxylate (PubChem CID 175213833) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4S)-4-acetyl-2-(dimethylcarbamoyl)-2-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4S)-4-acetyl-2-(dimethylcarbamoyl)-2-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175213833 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4S)-4-acetyl-2-(dimethylcarbamoyl)-2-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(=O)[C@@H]1CN(C(=O)OCc2ccc([N+](=O)[O-])cc2)[C@](S)(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C17H21N3O6S/c1-11(21)13-8-17(27,15(22)18(2)3)19(9-13)16(23)26-10-12-4-6-14(7-5-12)20(24)25/h4-7,13,27H,8-10H2,1-3H3/t13-,17+/m0/s1 |
| InChIKey | ILOVHDFFOVOVQT-SUMWQHHRSA-N |
| XLogP | 1.86 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|