C19H25N3O7S — CID 57056386
(4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-(dimethylcarbamoyl)-2-(methoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 57056386) has the molecular formula C19H25N3O7S and a molecular weight of 439.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-(dimethylcarbamoyl)-2-(methoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-(dimethylcarbamoyl)-2-(methoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57056386 |
| Molecular Formula | C19H25N3O7S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-(dimethylcarbamoyl)-2-(methoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | COC[C@]1(C(=O)N(C)C)C[C@H](SC(C)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H25N3O7S/c1-13(23)30-16-9-19(12-28-4,17(24)20(2)3)21(10-16)18(25)29-11-14-5-7-15(8-6-14)22(26)27/h5-8,16H,9-12H2,1-4H3/t16-,19-/m0/s1 |
| InChIKey | BWGHOLSYOIKTCM-LPHOPBHVSA-N |
| XLogP | 2.06 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|