C27H43NO5Si — CID 173388210
benzyl (2R,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(Z)-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-3-enyl]pyrrolidine-1-carboxylate (PubChem CID 173388210) has the molecular formula C27H43NO5Si and a molecular weight of 489.73 g/mol. Its IUPAC name is benzyl (2R,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(Z)-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-3-enyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(Z)-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-3-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173388210 |
| Molecular Formula | C27H43NO5Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | benzyl (2R,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(Z)-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-3-enyl]pyrrolidine-1-carboxylate |
| SMILES | C[SiH](C)O[C@]1(CC/C=C\C(=O)OC(C)(C)C)C[C@H](C(C)(C)C)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H43NO5Si/c1-25(2,3)22-18-27(33-34(7)8,17-13-12-16-23(29)32-26(4,5)6)28(19-22)24(30)31-20-21-14-10-9-11-15-21/h9-12,14-16,22,34H,13,17-20H2,1-8H3/b16-12-/t22-,27+/m0/s1 |
| InChIKey | IBQHEZMLHVTYLU-IOQXSLPCSA-N |
| XLogP | 6.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|