C19H40BN2O4Si — CID 173291484
CID 173291484 (PubChem CID 173291484) has the molecular formula C19H40BN2O4Si and a molecular weight of 399.44 g/mol.
| Compound Name | CID 173291484 |
|---|---|
| PubChem CID | 173291484 |
| Molecular Formula | C19H40BN2O4Si |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | — |
| SMILES | C[SiH](C)O[C@@]1(CCCNCO)C[C@H](C(C)(C)C)CN1C(=O)OC(C)(C)C.[B] |
| InChI | InChI=1S/C19H40N2O4Si.B/c1-17(2,3)15-12-19(25-26(7)8,10-9-11-20-14-22)21(13-15)16(23)24-18(4,5)6;/h15,20,22,26H,9-14H2,1-8H3;/t15-,19-;/m0./s1 |
| InChIKey | SNUORNLFRFDMTK-GIDGLZBFSA-N |
| XLogP | 2.92 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|