C16H31NO4Si — CID 173210248
tert-butyl 4-tert-butyl-2-dimethylsilyloxy-2-formylpyrrolidine-1-carboxylate (PubChem CID 173210248) has the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. Its IUPAC name is tert-butyl 4-tert-butyl-2-dimethylsilyloxy-2-formylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-tert-butyl-2-dimethylsilyloxy-2-formylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173210248 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | tert-butyl 4-tert-butyl-2-dimethylsilyloxy-2-formylpyrrolidine-1-carboxylate |
| SMILES | C[SiH](C)OC1(C=O)CC(C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31NO4Si/c1-14(2,3)12-9-16(11-18,21-22(7)8)17(10-12)13(19)20-15(4,5)6/h11-12,22H,9-10H2,1-8H3 |
| InChIKey | WJRLLNIWMRFVPE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|