C19H32ClNO5Si — CID 173349448
prop-2-enyl (2S,4R)-4-tert-butyl-2-(2-chloro-3-ethoxy-3-oxoprop-1-enyl)-2-dimethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 173349448) has the molecular formula C19H32ClNO5Si and a molecular weight of 418.01 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-tert-butyl-2-(2-chloro-3-ethoxy-3-oxoprop-1-enyl)-2-dimethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-tert-butyl-2-(2-chloro-3-ethoxy-3-oxoprop-1-enyl)-2-dimethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173349448 |
| Molecular Formula | C19H32ClNO5Si |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-tert-butyl-2-(2-chloro-3-ethoxy-3-oxoprop-1-enyl)-2-dimethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](C(C)(C)C)C[C@@]1(C=C(Cl)C(=O)OCC)O[SiH](C)C |
| InChI | InChI=1S/C19H32ClNO5Si/c1-8-10-25-17(23)21-13-14(18(3,4)5)11-19(21,26-27(6)7)12-15(20)16(22)24-9-2/h8,12,14,27H,1,9-11,13H2,2-7H3/t14-,19-/m0/s1 |
| InChIKey | VNOQXKYPXSKRGR-LIRRHRJNSA-N |
| XLogP | 4.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|