C16H34N2O3Si — CID 173254372
tert-butyl (2S,4R)-2-(aminomethyl)-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 173254372) has the molecular formula C16H34N2O3Si and a molecular weight of 330.55 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-(aminomethyl)-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-(aminomethyl)-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173254372 |
| Molecular Formula | C16H34N2O3Si |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl (2S,4R)-2-(aminomethyl)-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | C[SiH](C)O[C@]1(CN)C[C@H](C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H34N2O3Si/c1-14(2,3)12-9-16(11-17,21-22(7)8)18(10-12)13(19)20-15(4,5)6/h12,22H,9-11,17H2,1-8H3/t12-,16-/m0/s1 |
| InChIKey | HCUUQYKJYMKFTR-LRDDRELGSA-N |
| XLogP | 2.94 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|