C17H30FNO3Si — CID 173348366
prop-2-enyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(E)-3-fluoroprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 173348366) has the molecular formula C17H30FNO3Si and a molecular weight of 343.52 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(E)-3-fluoroprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(E)-3-fluoroprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173348366 |
| Molecular Formula | C17H30FNO3Si |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(E)-3-fluoroprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](C(C)(C)C)C[C@@]1(/C=C/CF)O[SiH](C)C |
| InChI | InChI=1S/C17H30FNO3Si/c1-7-11-21-15(20)19-13-14(16(2,3)4)12-17(19,9-8-10-18)22-23(5)6/h7-9,14,23H,1,10-13H2,2-6H3/b9-8+/t14-,17+/m0/s1 |
| InChIKey | SNDDSRNZJKPRPZ-JBRJIWJGSA-N |
| XLogP | 3.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|